|
|
| | 1-(3-AMINOPROPYL)-4-METHYLPIPERAZINE Basic information |
| Product Name: | 1-(3-AMINOPROPYL)-4-METHYLPIPERAZINE | | Synonyms: | RARECHEM AL BW 2461;N-(GAMMA-AMINOPROPYL)-N-METHYLPIPERAZINE;TIMTEC-BB SBB007289;4-methyl-1-piperazinepropanamin;AKOS B024994;AKOS BC-0592;3-(4-METHYLPIPERAZIN-1-YL)PROPAN-1-AMINE;3-(4-METHYL-PIPERAZIN-1-YL)-PROPYLAMINE | | CAS: | 4572-03-6 | | MF: | C8H19N3 | | MW: | 157.26 | | EINECS: | 224-954-4 | | Product Categories: | PIPERIDINE | | Mol File: | 4572-03-6.mol |  |
| | 1-(3-AMINOPROPYL)-4-METHYLPIPERAZINE Chemical Properties |
| Boiling point | 113-114°C 13mm | | density | 0,924 g/cm3 | | refractive index | 1.4810 | | Fp | 113-114°C/13mm | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 10.39±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Sensitive | Air Sensitive | | BRN | 105964 | | InChI | InChI=1S/C8H19N3/c1-10-5-7-11(8-6-10)4-2-3-9/h2-9H2,1H3 | | InChIKey | RGUABPVONIGVAT-UHFFFAOYSA-N | | SMILES | N1(CCCN)CCN(C)CC1 | | CAS DataBase Reference | 4572-03-6(CAS DataBase Reference) | | EPA Substance Registry System | 1-Piperazinepropanamine, 4-methyl- (4572-03-6) |
| Hazard Codes | Xi | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2735 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29335990 |
| Provider | Language |
|
ALFA
| English |
| | 1-(3-AMINOPROPYL)-4-METHYLPIPERAZINE Usage And Synthesis |
| Uses | 1-(3-Aminopropyl)-4-methylpiperazine is used as a precursor in organic synthesis for the preparation of furan-2-carboxylic acid [3-(4-methyl-piperazin-1-yl)-propyl]-amide by reacting with furan-2-carbonyl chloride. |
| | 1-(3-AMINOPROPYL)-4-METHYLPIPERAZINE Preparation Products And Raw materials |
|