methyl 2-(benzyloxy)acetate manufacturers
|
| | methyl 2-(benzyloxy)acetate Basic information |
| Product Name: | methyl 2-(benzyloxy)acetate | | Synonyms: | methyl 2-(benzyloxy)acetate;METHYL (BENZYLOXY)ACETATE;Acetic acid, 2-(phenylmethoxy)-, methyl ester;Acetic acid, (phenylmethoxy)-, methyl ester;methyl2-phenylmethoxyacetate;benzyloxyacetic acidmethyl ester | | CAS: | 31600-43-8 | | MF: | C10H12O3 | | MW: | 180.2 | | EINECS: | | | Product Categories: | | | Mol File: | 31600-43-8.mol |  |
| | methyl 2-(benzyloxy)acetate Chemical Properties |
| Boiling point | 136.5 °C(Press: 15 Torr) | | density | 1.1029 g/cm3 | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C10H12O3/c1-12-10(11)8-13-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 | | InChIKey | QNEIZSSWCVSZOS-UHFFFAOYSA-N | | SMILES | C(OC)(=O)COCC1=CC=CC=C1 |
| | methyl 2-(benzyloxy)acetate Usage And Synthesis |
| Uses | Methyl 2-(benzyloxy)acetate is a useful reactant for the synthesis of various organic compounds. | | References | [1] Chemistry - A European Journal, 1999, vol. 5, # 1, p. 121 - 161
[2] European Journal of Organic Chemistry, 2006, # 6, p. 1489 - 1498
[3] Patent: WO2010/127272, 2010, A2. Location in patent: Page/Page column 86; 87
[4] Angewandte Chemie - International Edition, 2014, vol. 53, # 5, p. 1334 - 1337
[5] Angew. Chem., 2014, vol. 126, # 5, p. 1358 - 1361 |
| | methyl 2-(benzyloxy)acetate Preparation Products And Raw materials |
|