|
|
| | 1-Boc-3-methylaminopiperidine Basic information |
| | 1-Boc-3-methylaminopiperidine Chemical Properties |
| Boiling point | 95-99℃/0.6mm | | density | 0.983 g/cm3 at 25 °C | | refractive index | n20/D1.467 | | Fp | >110℃ | | storage temp. | 2-8°C | | pka | 10.10±0.20(Predicted) | | form | liquid | | color | Colourless | | InChI | 1S/C11H22N2O2/c1-11(2,3)15-10(14)13-7-5-6-9(8-13)12-4/h9,12H,5-8H2,1-4H3 | | InChIKey | XRRRUOWSHGFPTI-UHFFFAOYSA-N | | SMILES | CNC1CCCN(C1)C(=O)OC(C)(C)C | | CAS DataBase Reference | 392331-89-4(CAS DataBase Reference) |
| Hazard Codes | Xi,N,T | | Risk Statements | 36/37/38-50-25 | | Safety Statements | 26-36/37/39-61-45 | | RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 2933399990 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-Boc-3-methylaminopiperidine Usage And Synthesis |
| Uses | Reactant for synthesis of:
- TRPV1 antagonists
- Aminopiperidines as iNOS inhibitors
|
| | 1-Boc-3-methylaminopiperidine Preparation Products And Raw materials |
|