|
|
| | 3,4-Difluorophenyl isothiocyanate Basic information |
| Product Name: | 3,4-Difluorophenyl isothiocyanate | | Synonyms: | DFNCS (1,2-DIFLUORO-4-ISOTHIOCYANATOBENZENE);Benzene, 1,2-difluoro-4-isothiocyanato- (9CI);3,4-Difluorophenyl isothiocyanate 99%;3,4-Difluorophenylisothiocyanate99%;3,4-DIFLUOROPHENYL ISOTHIOCYANATE;3,4-DIFLUORO-(ISOTHIOCYANATO)-BENZENE;3,4-DifluorophenylIsothiocyanate>Benzene, 1,2-difluoro-4-isothiocyanato- | | CAS: | 113028-75-4 | | MF: | C7H3F2NS | | MW: | 171.17 | | EINECS: | | | Product Categories: | Fluorine series;ISOTHIOCYANATE | | Mol File: | 113028-75-4.mol |  |
| | 3,4-Difluorophenyl isothiocyanate Chemical Properties |
| Boiling point | 170°C(lit.) | | density | 1.26±0.1 g/cm3(Predicted) | | refractive index | 1.5970 to 1.6010 | | form | liquid | | color | Yellow | | InChI | InChI=1S/C7H3F2NS/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H | | InChIKey | SVZKYXSJICYUOH-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(N=C=S)C=C1F | | CAS DataBase Reference | 113028-75-4(CAS DataBase Reference) |
| RIDADR | UN 2810 6.1/PG III | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2930909899 |
| | 3,4-Difluorophenyl isothiocyanate Usage And Synthesis |
| | 3,4-Difluorophenyl isothiocyanate Preparation Products And Raw materials |
|