| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-Desethyl amodiaquine-d5 Basic information |
| | N-Desethyl amodiaquine-d5 Chemical Properties |
| Melting point | 179-181°C | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Brown | | InChI | 1S/C18H18ClN3O/c1-2-20-11-12-9-14(4-6-18(12)23)22-16-7-8-21-17-10-13(19)3-5-15(16)17/h3-10,20,23H,2,11H2,1H3,(H,21,22)/i1D3,2D2 | | InChIKey | VRXFDHAGFYWGHT-ZBJDZAJPSA-N | | SMILES | [2H]C([2H])([2H])C([2H])([2H])NCc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1O | | CAS Number Unlabeled | 79352-78-6 |
| Hazard Codes | T | | Risk Statements | 25-37/38-41 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 4
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-Desethyl amodiaquine-d5 Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | A labelled metabolite of Amodiaquine, an antimalarial | | Uses | A labelled metabolite of Amodiaquine (A634200), an antimalarial. |
| | N-Desethyl amodiaquine-d5 Preparation Products And Raw materials |
|