- 1-BROMO-3-FLUORO-4-IODOBENZENE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:105931-73-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Bromo-2-fluoro-1-iodobenzene Basic information |
| | 4-Bromo-2-fluoro-1-iodobenzene Chemical Properties |
| Melting point | 48-51 °C (lit.) | | Boiling point | 243.9±20.0 °C(Predicted) | | density | 2.2691 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Crystalline Powder, Crystals, and/or Chunks | | color | Off-white to beige | | Sensitive | Light Sensitive | | BRN | 4740250 | | InChI | InChI=1S/C6H3BrFI/c7-4-1-2-6(9)5(8)3-4/h1-3H | | InChIKey | XRMZKCQCINEBEI-UHFFFAOYSA-N | | SMILES | C1(I)=CC=C(Br)C=C1F | | CAS DataBase Reference | 105931-73-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Bromo-2-fluoro-1-iodobenzene Usage And Synthesis |
| Chemical Properties | Clear colourless to light yellow liquid | | Uses | 3-Fluoro-4-iodobromobenzene may be used in chemical synthesis. |
| | 4-Bromo-2-fluoro-1-iodobenzene Preparation Products And Raw materials |
|