2-methyl-1,10-phenanthroline manufacturers
|
| | 2-methyl-1,10-phenanthroline Basic information | | Uses |
| | 2-methyl-1,10-phenanthroline Chemical Properties |
| Melting point | 50-53 °C | | Boiling point | 175°C/0.2mmHg(lit.) | | density | 1.211±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 5.63±0.40(Predicted) | | color | Light orange to Yellow to Green | | λmax | 267nm(H2O (pH10))(lit.) | | InChI | InChI=1S/C13H10N2/c1-9-4-5-11-7-6-10-3-2-8-14-12(10)13(11)15-9/h2-8H,1H3 | | InChIKey | LQZDYPHFVGRHKD-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC=C3)C=CC=1C |
| | 2-methyl-1,10-phenanthroline Usage And Synthesis |
| Uses | 2-Methyl-1,10-phenanthroline can be used as a pharmaceutical intermediate for pharmaceutical synthesis and experimental research. |
| | 2-methyl-1,10-phenanthroline Preparation Products And Raw materials |
|