|
|
| | 3,20-Dioxopregn-4-en-17-beta-yl acetate Basic information |
| Product Name: | 3,20-Dioxopregn-4-en-17-beta-yl acetate | | Synonyms: | 17-HYDROXYPROGESTERONE ACETATE;17-ALPHA-HYDROXYPROGESTERONE 17-ACETATE;17ALPHA-HYDROXYPROGESTERONE ACETATE;17ALPHA-HYDROXY-4-PREGNENE-3,20-DIONE 17-ACETATE;17ALPHA-ACETOXYPROGESTERONE;Acetoxypro;17-ACETOXYPROGESTERONE;17ALPHA-ACETOXY-4-PREGNENE-3,20-DIONE | | CAS: | 17308-02-0 | | MF: | C23H32O4 | | MW: | 372.51 | | EINECS: | 241-337-5 | | Product Categories: | | | Mol File: | 17308-02-0.mol |  |
| | 3,20-Dioxopregn-4-en-17-beta-yl acetate Chemical Properties |
| Melting point | 198 °C | | Boiling point | 490.2±45.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | InChI | InChI=1/C23H32O4/c1-14(24)23(27-15(2)25)12-9-20-18-6-5-16-13-17(26)7-10-21(16,3)19(18)8-11-22(20,23)4/h13,18-20H,5-12H2,1-4H3/t18-,19+,20+,21+,22+,23-/s3 | | InChIKey | VTHUYJIXSMGYOQ-NCZDLRRGNA-N | | SMILES | O([C@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)C(=O)C)C(=O)C |&1:1,4,6,16,18,22,r| | | CAS DataBase Reference | 17308-02-0(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 40-48 | | Safety Statements | 22-24/25-45 | | RIDADR | UN 2811 6.1/PG 2 | | WGK Germany | 3 | | RTECS | TU5074000 |
| | 3,20-Dioxopregn-4-en-17-beta-yl acetate Usage And Synthesis |
| Chemical Properties | Crystallized (acetone). Melting point 246.5℃. | | Uses | 3,20-Dioxopregn-4-en-17-beta-yl acetate, also known as 17-Hydroxyprogesterone acetate, is a new steroid
for oral administration. It has a progestational activity
which is at least twice that of anhydrohydroxyprogesterone[1]. | | Mechanism of action | 3,20-Dioxopregn-4-en-17-beta-yl acetate could induces secretory changes in the endometrium and luteal changes in the exfoliated vaginal epithelial cells, reduces fern-like patterns of the cervical mucus, causes a rise of basal body temperature, and induces withdrawal bleeding in castrates[1]. | | References | [1] Davis M, et al. 17-α-HYDROXYPROGESTERONE ACETATE; AN EFFECTIVE PROGESTATIONAL SUBSTANCE ON ORAL ADMINISTRATION. The Journal of clinical endocrinology and metabolism, 1957; 17: 1237–1244,. |
| | 3,20-Dioxopregn-4-en-17-beta-yl acetate Preparation Products And Raw materials |
|