|
|
| Product Name: | TLCK | | Synonyms: | TOS-LYS-CHLOROMETHYLKETONE HCL;TOS-LYS-CMK HCL;TOSYL-L-LYSINE CHLOROMETHYLKETONE HCL;TOSYL-L-LYSYL-CHLOROMETHANE HCL;TLCK HYDROCHLORIDE;TLCK HCL;TLCK;p-N-(7-amino-1-chloro-2-oxohept-3-yl)toluenesulphonamide | | CAS: | 4238-41-9 | | MF: | C14H22Cl2N2O3S | | MW: | 369.3 | | EINECS: | 224-199-0 | | Product Categories: | | | Mol File: | 4238-41-9.mol |  |
| Melting point | ~165 °C (dec.) | | storage temp. | 2-8°C | | solubility | H2O: 50 mg/mL | | form | powder | | color | white to pink | | Water Solubility | Soluble in water | | InChI | 1S/C14H21ClN2O3S.ClH/c1-11-5-7-12(8-6-11)21(19,20)17-13(14(18)10-15)4-2-3-9-16;/h5-8,13,17H,2-4,9-10,16H2,1H3;1H/t13-;/m0./s1 | | InChIKey | YFCUZWYIPBUQBD-ZOWNYOTGSA-N | | SMILES | [S](=O)(=O)(N[C@@H](CCCC[N+H3])C(=O)CCl)c1ccc(cc1)C.[Cl-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | XT5160000 | | F | 10-21 | | Storage Class | 11 - Combustible Solids |
| Uses | Inhibitor of papain and trypsin | | Biological Activity | Cell permeable: no', 'EC50 = 80 μM blocking nitric oxide synthase induced by interferon-γ and lipopolysaccharides in macrophages', 'Primary Target trypsin like proteases', 'Product does not compete with ATP.', 'Reversible: no | | IC 50 | Caspase-3: 12.0 μM (IC50); Caspase-7: 19.3 μM (IC50); Caspase-6: 54.5 μM (IC50) |
| | TLCK Preparation Products And Raw materials |
|