| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 3-ACETYLPYRROLE
-
-
2025-12-24
- CAS:1072-82-8
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10
|
| | 3-Acetylpyrrole Basic information |
| Product Name: | 3-Acetylpyrrole | | Synonyms: | 1-(1H-PYRROL-3-YL)-ETHANONE;BUTTPARK 97\57-37;3-Acetyl-1H-pyrrole;Methyl3-pyrrolylketone;3-Acetyl-pyrrole, 97 %;Ethanone, 1-(1H-pyrrol-3-yl)-;1-(1H-PYRROL-3-YL)ETHAN-1-ONE;3-Acetylpyrrole | | CAS: | 1072-82-8 | | MF: | C6H7NO | | MW: | 109.13 | | EINECS: | 000-000-0 | | Product Categories: | Azoles;blocks | | Mol File: | 1072-82-8.mol |  |
| | 3-Acetylpyrrole Chemical Properties |
| Melting point | 115-117°C | | Boiling point | 220 C | | density | 1.099±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 15.37±0.50(Predicted) | | form | Solid | | color | Light Brown | | BRN | 107151 | | Stability: | Light Sensitive | | InChI | InChI=1S/C6H7NO/c1-5(8)6-2-3-7-4-6/h2-4,7H,1H3 | | InChIKey | KHHSXHXUQVNBGA-UHFFFAOYSA-N | | SMILES | C(=O)(C1C=CNC=1)C | | CAS DataBase Reference | 1072-82-8(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-36-22 | | Safety Statements | 26-36/37/39-36 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| Provider | Language |
|
ALFA
| English |
| | 3-Acetylpyrrole Usage And Synthesis |
| Uses | 3-Acetylpyrrole is a useful research reagent for organic synthesis and other chemical and pharmaceutical processes. | | Definition | ChEBI: 1-(1H-pyrrol-3-yl)ethan-1-one is an aromatic ketone. | | Synthesis Reference(s) | Canadian Journal of Chemistry, 58, p. 2527, 1980 DOI: 10.1139/v80-404 Synthetic Communications, 17, p. 401, 1987 DOI: 10.1080/00397918708063917 Tetrahedron Letters, 22, p. 4901, 1981 DOI: 10.1016/S0040-4039(01)92377-9 | | Synthesis | 3-Acetylpyrrole can be prepared from pyrrole. Pyrrole (10.0 g) was added to a well-stirred suspension of NaOH (17.9 g, 447.3 mmol) in 10 mL of dichloromethane. The reaction mixture was cooled to 0C. The reaction mixture was stirred for 10 min. A solution of benzenesulfonyl chloride (31.6 g) in 2 mL of dichloroethane was added dropwise to the reaction mixture. After the addition is complete, allow the reaction mixture to come to room temperature. The reaction mixture was allowed to stir overnight. Pour in 60 mL of H2O to quench the reaction. Separate the organic layer. Extract the aqueous layer with dichloromethane (3 60 mL). Wash the combined organic extracts with water to neutral. Dry the combined organic extracts with Na2SO4. Remove the solvent. The residue was purified by recrystallization to give 3-acetylpyrrole. |
| | 3-Acetylpyrrole Preparation Products And Raw materials |
|