| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
2,4-Di-tert-butylaniline manufacturers
|
| | 2,4-Di-tert-butylaniline Basic information |
| | 2,4-Di-tert-butylaniline Chemical Properties |
| Melting point | 18.5-19 °C | | Boiling point | 140-141 °C(Press: 13 Torr) | | density | 0.9176 g/cm3(Temp: 25 °C) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.11±0.10(Predicted) | | InChI | InChI=1S/C14H23N/c1-13(2,3)10-7-8-12(15)11(9-10)14(4,5)6/h7-9H,15H2,1-6H3 | | InChIKey | PWGOAQYJIYOGBG-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C(C)(C)C)C=C1C(C)(C)C |
| | 2,4-Di-tert-butylaniline Usage And Synthesis |
| | 2,4-Di-tert-butylaniline Preparation Products And Raw materials |
|