|
|
| | 4,9-Dihydro-6,8-dihydroxy-2,2,4,4-tetramethyl-9-(1-methylethyl)-5-(2-methyl-1-oxopropyl)-1H-xanthene-1,3(2H)-dione Basic information |
| Product Name: | 4,9-Dihydro-6,8-dihydroxy-2,2,4,4-tetramethyl-9-(1-methylethyl)-5-(2-methyl-1-oxopropyl)-1H-xanthene-1,3(2H)-dione | | Synonyms: | 4,9-Dihydro-6,8-dihydroxy-2,2,4,4-tetramethyl-9-(1-methylethyl)-5-(2-methyl-1-oxopropyl)-1H-xanthene-1,3(2H)-dione;Myrtucommulone B | | CAS: | 54247-23-3 | | MF: | C24H30O6 | | MW: | 414.49 | | EINECS: | | | Product Categories: | | | Mol File: | 54247-23-3.mol |  |
| | 4,9-Dihydro-6,8-dihydroxy-2,2,4,4-tetramethyl-9-(1-methylethyl)-5-(2-methyl-1-oxopropyl)-1H-xanthene-1,3(2H)-dione Chemical Properties |
| Boiling point | 561.1±50.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 7.17±0.70(Predicted) | | form | solid | | biological source | plant | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChI | 1S/C24H30O6/c1-10(2)14-15-12(25)9-13(26)16(18(27)11(3)4)19(15)30-21-17(14)20(28)23(5,6)22(29)24(21,7)8/h9-11,14,25-26H,1-8H3 | | InChIKey | AYAUOXWJIWVPSO-UHFFFAOYSA-N | | SMILES | O1c2c(c(cc(c2C(=O)C(C)C)O)O)C(C3=C1C(C(=O)C(C3=O)(C)C)(C)C)C(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4,9-Dihydro-6,8-dihydroxy-2,2,4,4-tetramethyl-9-(1-methylethyl)-5-(2-methyl-1-oxopropyl)-1H-xanthene-1,3(2H)-dione Usage And Synthesis |
| Uses | It is a natural product derived from plant source th at finds application in compound screening libraries, metabolomics, phytochemical, and pharmaceutical research. | | Biological Activity | According to the existing research, Myrtucommulone B exhibited strong inhibition of sEH (soluble epoxide hydrolase) activity, suggesting its potential role in regulating lipid metabolism and inflammation. Further, it also showed significant inhibition of α-glucosidase activity suggesting its potential as antidiabetic and antibacterial agents. |
| | 4,9-Dihydro-6,8-dihydroxy-2,2,4,4-tetramethyl-9-(1-methylethyl)-5-(2-methyl-1-oxopropyl)-1H-xanthene-1,3(2H)-dione Preparation Products And Raw materials |
|