|
|
| | 3-Methacryloxypropylmethyldimethoxysilane Basic information |
| Product Name: | 3-Methacryloxypropylmethyldimethoxysilane | | Synonyms: | 3-(dimethoxymethylsilyl)propyl methacrylate;3-METHACRYLOXYPROPYLMETHYLDIMETHOXY SILANE;gamma-Methacryloxypropylmethyldimethoxysilane;METHACRYLOXYPROPYLMETHYLDIMETHOXYSILANE 95+%;3-METHACRYLOXYPROPYLMETHYLDIMETHOXY SILANE(KH571);Methacryloxypropylmethyldimethoxysilane(inhibitedwithMEHQ);(3-Methyldimethoxysilyl)propylmethacylate;Methacryloxypropylmethyl dimethoxysilane 3-methacryloxypropylmethyldimethoxysilane | | CAS: | 14513-34-9 | | MF: | C10H20O4Si | | MW: | 232.35 | | EINECS: | 238-518-6 | | Product Categories: | Methacrylate Silanes;Acrylate;top | | Mol File: | 14513-34-9.mol |  |
| | 3-Methacryloxypropylmethyldimethoxysilane Chemical Properties |
| Boiling point | 65 °C | | density | 1 | | vapor pressure | 0.001-12790Pa at 20-25℃ | | refractive index | 1.433 | | Fp | 88°C | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | Specific Gravity | 1.0 | | color | Colorless to Almost colorless | | Odor | Mild odor | | Water Solubility | 240-1000000mg/L at 20℃ | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C10H20O4Si/c1-8(2)9(11)14-6-5-7-15-10(12-3)13-4/h10H,1,5-7,15H2,2-4H3 | | InChIKey | VLZDYNDUVLBNLD-UHFFFAOYSA-N | | SMILES | C(OCCC[SiH2]C(OC)OC)(=O)C(C)=C | | LogP | -0.82-3.4 at 20℃ | | CAS DataBase Reference | 14513-34-9(CAS DataBase Reference) |
| | 3-Methacryloxypropylmethyldimethoxysilane Usage And Synthesis |
| Chemical Properties | Clear to straw liquid with mild odor | | Uses | 3-Methacryloxypropylmethyldimethoxysilane is used as adhesion promoter at organic/inorgainc interfaces, as surface modifier (e.g. imparting water repellency, organophilic surface adjustment) or as crosslinking of polymers). It is used as a coupling agent to improve the physical and electrical properties of glass-reinforced and mineral-filled thermosetting resins under exposure to heat and/or moisture. | | Flammability and Explosibility | Not classified |
| | 3-Methacryloxypropylmethyldimethoxysilane Preparation Products And Raw materials |
|