| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
Indirubin-3'-monoxime-5-sulphonic acid manufacturers
|
| | Indirubin-3'-monoxime-5-sulphonic acid Basic information |
| Product Name: | Indirubin-3'-monoxime-5-sulphonic acid | | Synonyms: | 1H-Indole-5-sulfonic acid, 3-[1,3-dihydro-3-(hydroxyimino)-2H-indol-2-ylidene]-2,3-dihydro-2-oxo-;Indirubin3'monoxime5sulphonic acid,Indirubin 3' monoxime 5 sulphonic acid;Indirubin-3'-monoxime-5-sulphonic acid;Indirubin-3'-monoxime-5-sulphonic acid | | CAS: | 331467-05-1 | | MF: | C16H11N3O5S | | MW: | 357.34 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Indirubin-3'-monoxime-5-sulphonic acid Chemical Properties |
| storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | solid | | color | dark red | | InChI | 1S/C16H11N3O5S/c20-16-13(10-7-8(25(22,23)24)5-6-12(10)18-16)15-14(19-21)9-3-1-2-4-11(9)17-15/h1-7,17,19,21H,(H,22,23,24) | | InChIKey | IZDNACYDKBNHHC-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(O)c1c[c]2[c](cc1)=NC(=O)C=2c3[nH]c4c(c3NO)cccc4 |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | Indirubin-3'-monoxime-5-sulphonic acid Usage And Synthesis |
| Uses | Indirubin-3'-monoxime-5-sulphonic acid is a potent and selective inhibitor of CDK1, CDK5, and GSK-3β with IC50s of 5 nM, 7 nM, and 80 nM, respectively[1]. | | Biological Activity | Cell permeable: no', 'Primary Target
CDK1', 'Product competes with ATP.', 'Reversible: yes', 'Target IC50: 5 nM, 7 nM, 80 nM, against Cdk1, Cdk5, and glycogen synthase kinase-3β (GSK-3β), respectively | | IC 50 | CDK1: 5 nM (IC50); CDK5: 7 nM (IC50); GSK-3β: 80 nM (IC50) | | References | [1] Leclerc S, et al. Indirubins inhibit glycogen synthase kinase-3 beta and CDK5/p25, two protein kinases involved in abnormal tau phosphorylation in Alzheimer's disease. A property common to most cyclin-dependent kinase inhibitors. J Biol Chem. 2001 Jan 5;276(1):251-60. DOI:10.1074/jbc.M002466200 |
| | Indirubin-3'-monoxime-5-sulphonic acid Preparation Products And Raw materials |
|