|
|
| | BENZYLIDENE CAMPHOR Basic information |
| Product Name: | BENZYLIDENE CAMPHOR | | Synonyms: | 1,7,7-trimethyl-3-(phenylmethylene)-bicyclo[2.2.1]heptan-2-on;1,7,7-trimethyl-3-(phenylmethylene)-Bicyclo[2.2.1]heptan-2-one;BENZYLIDENE CAMPHOR;Bicyclo2.2.1heptan-2-one, 1,7,7-trimethyl-3-(phenylmethylene)-;3-BENZYLIDENE-BORNAN-2-ONE;1,7,7-Trimethyl-3-benzylidenebicyclo[2.2.1]heptane-2-one;3-Benzylidene-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one;2-benzylidene-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one | | CAS: | 15087-24-8 | | MF: | C17H20O | | MW: | 240.34 | | EINECS: | 239-139-9 | | Product Categories: | | | Mol File: | 15087-24-8.mol |  |
| | BENZYLIDENE CAMPHOR Chemical Properties |
| Melting point | 97 °C | | Boiling point | 310 °C | | density | 1.079±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Sparingly), Hexanes (Slightly), Methanol (Slightly) | | color | White to Off-White | | BRN | 1967440 | | Major Application | environmental | | Cosmetics Ingredients Functions | UV ABSORBER | | InChI | InChI=1S/C17H20O/c1-16(2)14-9-10-17(16,3)15(18)13(14)11-12-7-5-4-6-8-12/h4-8,11,14H,9-10H2,1-3H3 | | InChIKey | OIQXFRANQVWXJF-UHFFFAOYSA-N | | SMILES | C12(C)C(C)(C)C(CC1)C(=CC1=CC=CC=C1)C2=O | | LogP | 2.842 (est) | | EPA Substance Registry System | Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-3-(phenylmethylene)- (15087-24-8) |
| Hazard Codes | Xn | | Risk Statements | 63-62 | | Safety Statements | 36/37 | | WGK Germany | 3 | | RTECS | DT5099765 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | BENZYLIDENE CAMPHOR Usage And Synthesis |
| Uses | 3-benzylidene camphor is a sunscreen chemical with uVB-filtering and absorption capacities with an approved usage level of up to 2 percent in the european union. |
| | BENZYLIDENE CAMPHOR Preparation Products And Raw materials |
|