8-CYCLOPENTYL-1,3-DIMETHYLXANTHINE manufacturers
|
| | 8-CYCLOPENTYL-1,3-DIMETHYLXANTHINE Basic information |
| | 8-CYCLOPENTYL-1,3-DIMETHYLXANTHINE Chemical Properties |
| Melting point | 250-252°C | | Boiling point | 513.1±42.0 °C(Predicted) | | density | 1.332±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | H2O: <0.28 mg/mL, slightly soluble | | form | crystalline | | pka | 8.91±0.70(Predicted) | | color | white or off-white | | Water Solubility | Soluble in 0.1M NaOH. Slightly soluble in water. Also soluble in DMSO at 16mg/ml at 60°C. | | Stability: | Store in freezer; Solutions at 4°C stable for several days | | InChI | 1S/C12H16N4O2/c1-15-10-8(11(17)16(2)12(15)18)13-9(14-10)7-5-3-4-6-7/h7H,3-6H2,1-2H3,(H,13,14) | | InChIKey | SCVHFRLUNIOSGI-UHFFFAOYSA-N | | SMILES | CN1C(=O)N(C)c2nc([nH]c2C1=O)C3CCCC3 |
| WGK Germany | 3 | | RTECS | XH5093600 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),Journal of Medicinal Chemistry. Vol. 14, Pg. 1202, 1971. |
| | 8-CYCLOPENTYL-1,3-DIMETHYLXANTHINE Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A selective A1 adenosine receptor antagonist. Binding activity in rat brain membranes: Ki = 10.9 nM (A1 receptor); Ki = 1440 nM (A2 receptor). | | Definition | ChEBI: 8-cyclopentyl-1,3-dimethyl-7H-purine-2,6-dione is an oxopurine. | | Biological Activity | Selective A1 adenosine receptor antagonist. | | storage | Store at RT |
| | 8-CYCLOPENTYL-1,3-DIMETHYLXANTHINE Preparation Products And Raw materials |
|