- 3,5-Dimethylbenzaldehyde
-
- $6.68 / 1KG
-
2020-01-09
- CAS: 5779-95-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg-1000kg
|
| | 3,5-Dimethylbenzaldehyde Basic information |
| Product Name: | 3,5-Dimethylbenzaldehyde | | Synonyms: | 3,5-DIMETHYLBENZALDEHYDE;M-XYLENE-5-CARBOXALDEHYDE;3,5-DIMETHYLBENZALDEHYDE 99+%;3,5-Dimethylbenzaldehyde, 98+%;3,5-Dimethylbenzaldehyde, 97+%;3,5-Dimethylbenzaldehyde>Benzaldehyde, 3,5-dimethyl- | | CAS: | 5779-95-3 | | MF: | C9H10O | | MW: | 134.18 | | EINECS: | | | Product Categories: | Building Blocks;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Aldehydes;C9;Carbonyl Compounds;Aromatic Aldehydes & Derivatives (substituted) | | Mol File: | 5779-95-3.mol |  |
| | 3,5-Dimethylbenzaldehyde Chemical Properties |
| Melting point | 8-10 °C | | Boiling point | 232 °C (lit.) | | density | 0.998 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.538(lit.) | | Fp | 210 °F | | storage temp. | Inert atmosphere,2-8°C | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Water Solubility | Not miscible with water. | | Sensitive | Air Sensitive | | BRN | 2038840 | | Henry's Law Constant | 1.2×100 mol/(m3Pa) at 25℃, Wang et al. (2017) | | InChI | InChI=1S/C9H10O/c1-7-3-8(2)5-9(4-7)6-10/h3-6H,1-2H3 | | InChIKey | NBEFMISJJNGCIZ-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(C)=CC(C)=C1 | | LogP | 2.560 (est) | | CAS DataBase Reference | 5779-95-3(CAS DataBase Reference) | | NIST Chemistry Reference | Benzaldehyde, 3,5-dimethyl-(5779-95-3) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29122990 | | Storage Class | 10 - Combustible liquids |
| | 3,5-Dimethylbenzaldehyde Usage And Synthesis |
| Chemical Properties | clear colorless to yellow liquid | | Uses | 3,5-Dimethylbenzaldehyde is used to produce 2,3-bis-(3,5-dimethyl-phenyl)-succinonitrile by heating along with reagent NaCN and solvent H2O, methanol. |
| | 3,5-Dimethylbenzaldehyde Preparation Products And Raw materials |
| Raw materials | Benzene, 1-(iodomethyl)-3,5-dimethyl--->N-methoxy-N,3,5-trimethylbenzamide-->1-Iodo-3,5-dimethylbenzene-->3,5-DIMETHYLBENZYL ALCOHOL-->3,5-Dimethylbenzyl bromide-->carbon monoxide-->Mesitylene-->m-Xylene | | Preparation Products | METHYL 3,5-DIMETHYLBENZOATE-->1-ETHYNYL-3,5-DIMETHYL-BENZENE-->3,5-Dimethylbenzoic acid |
|