|
|
| | (-)-Di-p-toluoyl-L-tartaric acid Basic information | | Uses |
| | (-)-Di-p-toluoyl-L-tartaric acid Chemical Properties |
| Melting point | 169-171 °C(lit.) | | alpha | -142 º (c=10, EtOH) | | Boiling point | 432.57°C (rough estimate) | | density | 1.3084 (rough estimate) | | bulk density | 500kg/m3 | | refractive index | -139 ° (C=1, EtOH) | | storage temp. | Store below +30°C. | | solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 1.46±0.25(Predicted) | | form | Crystalline Powder | | color | White to yellow | | Optical Rotation | [α]20/D 138°, c = 1 in ethanol | | Water Solubility | soluble | | BRN | 2022481 | | InChI | 1S/C20H18O8/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m1/s1 | | InChIKey | CMIBUZBMZCBCAT-HZPDHXFCSA-N | | SMILES | Cc1ccc(cc1)C(=O)O[C@H]([C@@H](OC(=O)c2ccc(C)cc2)C(O)=O)C(O)=O | | CAS DataBase Reference | 32634-66-5(CAS DataBase Reference) | | EPA Substance Registry System | Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, [R-(R*,R*)]- (32634-66-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36/37-26 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29181300 | | Storage Class | 11 - Combustible Solids |
| | (-)-Di-p-toluoyl-L-tartaric acid Usage And Synthesis |
| Uses | (-)-di-p-toluoyl-l-tartaric acid can be used as a chiral resolving agent for the resolution of the racemic bases to isolate the (-)-enantiomeric forms.
| | Chemical Properties | white to light yellow crystal powde | | Uses | Escitalopram intermediate | | Uses | (-)-O,O’-Di-p-toluoyl-L-tartaric Acid is a useful reagent for the preparation of the upadacitinib salt compound. | | Uses | Inhibitor of enzyme | | General Description | (-)-O,O′-Di-p-toluoyl-L-tartaric acid is a O,O′-diacyl tartaric acid derivative that can be prepared by the resolution of its racemate in the presence of cinchonine. | | Synthesis | The general procedure for the synthesis of di-p-toluoyltartaric acid and compound (CAS: 243640-19-9) from compound (CAS: 869749-09-7) was as follows: (R)-α-(2,3-dimethoxyphenyl)-4-piperidine methanol was mixed with (2R,3R)-(-)-di-(p-toluoyl)tartaric acid salt (7 g) in 10 mL of concentrated ammonia and methanol were stirred well. After 2 hours of reaction, 30 mL of water was added and evaporated to remove methanol and ammonia. Subsequently, another 30 mL of water was added and the precipitate was collected, rinsed with water and dried to give (R)-α-(2,3-dimethoxyphenyl)-4-piperidine methanol (1), which typically has an enantiomeric excess of 85% (ee). After acidification of the aqueous layer with 1N hydrochloric acid, the precipitate was collected and dried to recover (2R,3R)-(-)-di-(p-toluoyl)tartaric acid. | | References | [1] Patent: EP1734037, 2006, A2. Location in patent: Page/Page column 53 |
| | (-)-Di-p-toluoyl-L-tartaric acid Preparation Products And Raw materials |
|