|
|
| | Ethyl cyclopropanecarboxylate Basic information |
| | Ethyl cyclopropanecarboxylate Chemical Properties |
| Boiling point | 129-133 °C (lit.) | | density | 0.96 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.420(lit.) | | Fp | 65 °F | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Methanol (Slightly) | | form | Liquid | | color | Clear pale yellow | | PH | 7 (H2O) | | Water Solubility | immiscible | | BRN | 2039752 | | InChI | InChI=1S/C6H10O2/c1-2-8-6(7)5-3-4-5/h5H,2-4H2,1H3 | | InChIKey | LDDOSDVZPSGLFZ-UHFFFAOYSA-N | | SMILES | C1(C(OCC)=O)CC1 | | CAS DataBase Reference | 4606-07-9(CAS DataBase Reference) | | NIST Chemistry Reference | Ethyl cyclopropanecarboxylate(4606-07-9) |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 16 | | RIDADR | UN 3272 3/PG 2 | | WGK Germany | 3 | | Hazard Note | Highly Flammable | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29162000 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | Ethyl cyclopropanecarboxylate Usage And Synthesis |
| Chemical Properties | clear pale yellow liquid | | Uses | Ethyl cyclopropanecarboxylate is a reagent used in the addition of cyclopropane. | | Uses | Ethyl cyclopropanecarboxylate is a reagent used in the addition of cyclopropane. It acts as annulation reagent for the conversion of aromatics to 2-methylindanones under Friedel-Crafts conditions. |
| | Ethyl cyclopropanecarboxylate Preparation Products And Raw materials |
|