| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | ACETIC ANHYDRIDE-2,2'-13C2,D6 Basic information |
| | ACETIC ANHYDRIDE-2,2'-13C2,D6 Chemical Properties |
| Melting point | -73 °C(lit.) | | Boiling point | 138-140 °C(lit.) | | density | 1.164 g/mL at 25 °F | | Fp | 54 °C | | InChI | 1S/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1+1D3,2+1D3 | | InChIKey | WFDIJRYMOXRFFG-KLFIIISESA-N | | SMILES | [2H][13C]([2H])([2H])C(=O)OC(=O)[13C]([2H])([2H])[2H] |
| Hazard Codes | C | | Risk Statements | 10-20/22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1715 8/PG 2 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| | ACETIC ANHYDRIDE-2,2'-13C2,D6 Usage And Synthesis |
| Uses | - High-resolution NMR spectroscopy - Metabolomic profiling and pathway analysis - Stable Isotope probing in Environmental microbiology - Chemical synthesis of labeled compounds |
| | ACETIC ANHYDRIDE-2,2'-13C2,D6 Preparation Products And Raw materials |
|