|
|
| | 2-Methylchromone Basic information |
| Product Name: | 2-Methylchromone | | Synonyms: | 2-Methylchromone;2-Methyl-4H-1-benzopyran-4-one;2-methylchromen-4-one;4H-1-Benzopyran-4-one, 2-methyl-;SKL551;2-methyl-4H-1-benzofuran-4-one;2-Methyl-4H-chroMen-4-one | | CAS: | 5751-48-4 | | MF: | C10H8O2 | | MW: | 160.17 | | EINECS: | | | Product Categories: | | | Mol File: | 5751-48-4.mol |  |
| | 2-Methylchromone Chemical Properties |
| Melting point | 72-73 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 249.5±33.0 °C(Predicted) | | density | 1.185±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C10H8O2/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 | | InChIKey | PXPNSQMWVPLERM-UHFFFAOYSA-N | | SMILES | C1(C)OC2=CC=CC=C2C(=O)C=1 |
| | 2-Methylchromone Usage And Synthesis |
| | 2-Methylchromone Preparation Products And Raw materials |
|