|
|
| | 5-Mercapto-1-methyltetrazole Basic information |
| | 5-Mercapto-1-methyltetrazole Chemical Properties |
| Melting point | 125-128 °C (lit.) | | Boiling point | 111.6±23.0 °C(Predicted) | | density | 1.420 (estimate) | | refractive index | 1.5605 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 0.70±0.20(Predicted) | | form | solid | | color | White to Off-White | | Sensitive | Air Sensitive | | InChI | InChI=1S/C2H4N4S/c1-6-2(7)3-4-5-6/h1H3,(H,3,5,7) | | InChIKey | XOHZHMUQBFJTNH-UHFFFAOYSA-N | | SMILES | N1(C)C(=S)N=NN1 | | CAS DataBase Reference | 13183-79-4(CAS DataBase Reference) | | EPA Substance Registry System | 5H-Tetrazole-5-thione, 1,2-dihydro-1-methyl- (13183-79-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-24/25 | | RIDADR | transport forbidden | | WGK Germany | 3 | | RTECS | XF7600000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29339900 | | Storage Class | 4.1A - Other explosive hazardous materials | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Mercapto-1-methyltetrazole Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | N-Methyl-5-tetrazolethiol (Cefoperazone EP Impurity C) is an impurity of Cefoperazone. | | Uses | 5-Mercapto-1-methyltetrazole may be employed as heterocyclic ligand to study the geometry and stereochemical activity of the lone pair at the lead atom in hemi- and holo-directed lead(II) complexes. It may be used in the chemical modification of submicron particles of mesoporous MSU-2 silica and SBA-15 mesoporous silica. | | General Description | 5-Mercapto-1-methyltetrazole is a heterocyclic thiol derivative. It forms dimeric or tetrameric complexes with trimethylgallium. | | Safety Profile | Poison by
intraperitoneal route. Experimental
reproductive effects. When heated to
decomposition it emits very toxic fumes of
NOx and SOx. |
| | 5-Mercapto-1-methyltetrazole Preparation Products And Raw materials |
|