|
|
| | 1-BROMO-3-CHLORO-5-IODOBENZENE Basic information |
| Product Name: | 1-BROMO-3-CHLORO-5-IODOBENZENE | | Synonyms: | 1-BROMO-3-CHLORO-5-IODOBENZENE;3-Bromo-5-chloroiodobenzene;Benzene, 1-bromo-3-chloro-5-iodo-;1-BROMO-3-CHLORO-5-IODOBENZENE ISO 9001：2015 REACH;1-BROMO-3-CHLORO-5-IODOBENZENE 13101-40-1 | | CAS: | 13101-40-1 | | MF: | C6H3BrClI | | MW: | 317.35 | | EINECS: | | | Product Categories: | | | Mol File: | 13101-40-1.mol |  |
| | 1-BROMO-3-CHLORO-5-IODOBENZENE Chemical Properties |
| Melting point | 85.8℃ | | Boiling point | 280.4±25.0℃ (760 Torr) | | density | 2.272±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 123.4±23.2℃ | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | color | Light yellow to Brown | | InChI | InChI=1S/C6H3BrClI/c7-4-1-5(8)3-6(9)2-4/h1-3H | | InChIKey | RSGRRCWDCXLEHS-UHFFFAOYSA-N | | SMILES | C1(Br)=CC(I)=CC(Cl)=C1 |
| | 1-BROMO-3-CHLORO-5-IODOBENZENE Usage And Synthesis |
| Synthesis | 1-Bromo-3-chloro-5-iodobenzene was prepared by an eight-step synthesis with benzene as the raw material. Each step requires only a short reaction time and the individual yields are in the range of 62-96%[1].
 | | References | [1] ADDISON AULT; Raymond K. 1-bromo-3-chloro-5-iodobenzene: An eight-step synthesis from benzene[J]. Journal of Chemical Education, 1966. DOI:10.1021/ed043p213. |
| | 1-BROMO-3-CHLORO-5-IODOBENZENE Preparation Products And Raw materials |
|