|
|
| | 11BETA,17ALPHA-DIHYDROXY-4-PREGNENE-3,20-DIONE Basic information |
| Product Name: | 11BETA,17ALPHA-DIHYDROXY-4-PREGNENE-3,20-DIONE | | Synonyms: | 21-deoxycortisol;21 DEOXYCORTISOL 21-DESOXYCORTISOL;21-DESOXYCORTISOL;11BETA,17ALPHA-DIHYDROXY-4-PREGNENE-3,20-DIONE;11BETA,17ALPHA-DIHYDROXY-PROGESTERONE;4-PREGNENE-11BETA,17ALPHA-DIOL-3,20-DIONE;4-PREGNEN-11BETA,17ALPHA-DIOL-3,20-DIONE;4-PREGNEN-11-BETA, 17-DIOL-3,20-DIONE | | CAS: | 641-77-0 | | MF: | C21H30O4 | | MW: | 346.46 | | EINECS: | 211-375-7 | | Product Categories: | Steroids;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 641-77-0.mol |  |
| | 11BETA,17ALPHA-DIHYDROXY-4-PREGNENE-3,20-DIONE Chemical Properties |
| Melting point | 225-228 °C | | Boiling point | 523.9±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | Fp | 9℃ | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly, Heated) | | pka | 12.86±0.70(Predicted) | | form | Solid | | color | White to Pale Yellow | | Major Application | clinical testing
clinical testing | | InChI | 1S/C21H30O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h10,15-18,24-25H,4-9,11H2,1-3H3/t15-,16-,17-,18+,19-,20-,21-/m0/s1 | | InChIKey | LCZBQMKVFQNSJR-UJPCIWJBSA-N | | SMILES | CC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC12C |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | 11BETA,17ALPHA-DIHYDROXY-4-PREGNENE-3,20-DIONE Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 21-Deoxy Cortisol (Hydrocortisone EP Impurity L) is a metabolite of Fluticasone propionate (F599500). | | Uses | A metabolite of Fluticasone propionate (F599500). | | Definition | ChEBI: 21-deoxycortisol is a deoxycortisol that is 17xi-pregn-4-ene-3,20-dione substituted by a beta-hydroxy group at position 11 and an alpha-hydroxy group at position 17. It is a marker of virilizing adrenal hyperplasia caused by 21-hydroxylase deficiency. It has a role as a human blood serum metabolite and a mouse metabolite. It is an 11beta-hydroxy steroid, a 17alpha-hydroxy-C21-steroid, a tertiary alpha-hydroxy ketone and a deoxycortisol. | | IC 50 | Human Endogenous Metabolite |
| | 11BETA,17ALPHA-DIHYDROXY-4-PREGNENE-3,20-DIONE Preparation Products And Raw materials |
|