|
|
| | Eprodisate Basic information |
| Product Name: | Eprodisate | | Synonyms: | 1,3-PROPANEDISULFONIC ACID;1,3-PROPANEDISULFONIC ACID DISODIUM SALT;DISODIUM PROPANE-1,3-DISULFONATE;DISODIUM 1,3-PROPANEDISULFONATE;DISODIUM 1,3-PROPANEDISULPHONATE;1,3-Propanedisulphonic acid disodium salt;1,3-PROPANEDISULFONIC ACID 70%*AQUEOUS S OLUTION;1,3-Propanedisulfonic acid, 70% w/v aq. soln. | | CAS: | 21668-77-9 | | MF: | C3H8O6S2 | | MW: | 204.22 | | EINECS: | | | Product Categories: | Organic Building Blocks;Sulfonic/Sulfinic Acids;Sulfur Compounds | | Mol File: | 21668-77-9.mol |  |
| | Eprodisate Chemical Properties |
| Melting point | 120-124 ºC | | Boiling point | 157 °C(Press: 1.4 Torr) | | density | 1.33 | | refractive index | 1.4220 | | storage temp. | Store at -20°C | | solubility | DMSO: ≥ 125 mg/mL (612.09 mM) | | form | clear liquid | | pka | 1.21±0.50(Predicted) | | color | Colorless to Light yellow | | InChI | InChI=1S/C3H8O6S2/c4-10(5,6)2-1-3-11(7,8)9/h1-3H2,(H,4,5,6)(H,7,8,9) | | InChIKey | MGNVWUDMMXZUDI-UHFFFAOYSA-N | | SMILES | C(S(O)(=O)=O)CCS(O)(=O)=O | | CAS DataBase Reference | 21668-77-9(CAS DataBase Reference) |
| Hazard Codes | Xi,C | | Risk Statements | 36/37/38-34-20/21/22 | | Safety Statements | 26-36-45-36/37/39-27 | | RIDADR | 3265 | | WGK Germany | 3 | | HS Code | 2904.10.5000 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | Eprodisate Usage And Synthesis |
| Uses | Treatment of secondary (AA) amyloidosis. |
| | Eprodisate Preparation Products And Raw materials |
|