|
|
| | Ethane-1,2-di(sulfonyl chloride) Basic information |
| Product Name: | Ethane-1,2-di(sulfonyl chloride) | | Synonyms: | Ethane-1,2-di(sulfonyl chloride);ethane-1,2-disulfonyl dichloride;1,2-Ethanedisulfonyl dichloride;1,2 Ethane Disulfonyl Chloride;1,2-butane disulfonyl chloride | | CAS: | 31469-08-6 | | MF: | C2H4Cl2O4S2 | | MW: | 227.09 | | EINECS: | | | Product Categories: | | | Mol File: | 31469-08-6.mol |  |
| | Ethane-1,2-di(sulfonyl chloride) Chemical Properties |
| Melting point | 34-36 °C(Solv: benzene (71-43-2)) | | Boiling point | 306.2±25.0 °C(Predicted) | | density | 1.796±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C2H4Cl2O4S2/c3-9(5,6)1-2-10(4,7)8/h1-2H2 | | InChIKey | VRHMNTYGRQBMGR-UHFFFAOYSA-N | | SMILES | C(S(Cl)(=O)=O)CS(Cl)(=O)=O |
| | Ethane-1,2-di(sulfonyl chloride) Usage And Synthesis |
| | Ethane-1,2-di(sulfonyl chloride) Preparation Products And Raw materials |
|