| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
OTAVA chemicals |
| Tel: |
416 305 9979 (Canada) |
| Email: |
north.america@otavachemicals.com |
|
| | AURORA 16490 Basic information |
| Product Name: | AURORA 16490 | | Synonyms: | AURORA 16490;OTAVA-BB BB7013161804;1-(2,4-Dihydroxyphenyl)-2-(4-ethylphenoxy)ethanone | | CAS: | | | MF: | C16H16O4 | | MW: | 272.3 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | AURORA 16490 Chemical Properties |
| form | solid | | InChI | 1S/C16H16O4/c1-2-11-3-6-13(7-4-11)20-10-16(19)14-8-5-12(17)9-15(14)18/h3-9,17-18H,2,10H2,1H3 | | InChIKey | RHBSLIMVGWKFQW-UHFFFAOYSA-N | | SMILES | O(CC(=O)c2c(cc(cc2)O)O)c1ccc(cc1)CC |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | AURORA 16490 Usage And Synthesis |
| | AURORA 16490 Preparation Products And Raw materials |
|