| Company Name: |
Hubei Merclaide Material Co.， Ltd. Gold
|
| Tel: |
18526707169 |
| Email: |
40538734@qq.com |
| Products Intro: |
Product Name:2-Amino-5-tert-butylbenzonitrile
CAS:874814-72-9
Purity:97+%，HPLC Package:5g,10g,25g,50g,100g,250g.500g
|
|
| | BUTTPARK 83\07-21 Basic information | | Uses |
| Product Name: | BUTTPARK 83\07-21 | | Synonyms: | BUTTPARK 83\07-21;2-Amino-5-tert-butyl-benzonitrile;Benzonitrile, 2-amino-5-(1,1-dimethylethyl)- | | CAS: | 874814-72-9 | | MF: | C11H14N2 | | MW: | 174.24 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | BUTTPARK 83\07-21 Chemical Properties |
| Boiling point | 304.6±35.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 2.14±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C11H14N2/c1-11(2,3)9-4-5-10(13)8(6-9)7-12/h4-6H,13H2,1-3H3 | | InChIKey | FUXLXBOWPNXOJZ-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(C(C)(C)C)=CC=C1N |
| | BUTTPARK 83\07-21 Usage And Synthesis |
| Uses | 2-Amino-5-tert-butylbenzonitrile is a nitrile derivative that can be used as an intermediate in dye synthesis. |
| | BUTTPARK 83\07-21 Preparation Products And Raw materials |
|