|
|
| | 2,4,6-Trichloro-pyrido[3,2-d]pyrimidine Basic information |
| Product Name: | 2,4,6-Trichloro-pyrido[3,2-d]pyrimidine | | Synonyms: | 2,4,6-Trichloro-pyrido[3,2-d]pyrimidine;Pyrido[3,2-d]pyrimidine, 2,4,6-trichloro- | | CAS: | 1036738-12-1 | | MF: | C7H2Cl3N3 | | MW: | 234.47 | | EINECS: | | | Product Categories: | | | Mol File: | 1036738-12-1.mol | ![2,4,6-Trichloro-pyrido[3,2-d]pyrimidine Structure](CAS2/GIF/1036738-12-1.gif) |
| | 2,4,6-Trichloro-pyrido[3,2-d]pyrimidine Chemical Properties |
| storage temp. | -20°C, sealed storage, away from moisture | | Appearance | White to yellow Solid | | InChI | InChI=1S/C7H2Cl3N3/c8-4-2-1-3-5(12-4)6(9)13-7(10)11-3/h1-2H | | InChIKey | KPUMPJIRBVOFGW-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(Cl)=C2N=C(Cl)C=CC2=N1 |
| | 2,4,6-Trichloro-pyrido[3,2-d]pyrimidine Usage And Synthesis |
| | 2,4,6-Trichloro-pyrido[3,2-d]pyrimidine Preparation Products And Raw materials |
|