| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-(Methoxycarbonyl)-1H-indole-2-carboxylicacid Basic information |
| | 5-(Methoxycarbonyl)-1H-indole-2-carboxylicacid Chemical Properties |
| Boiling point | 471.9±25.0 °C(Predicted) | | density | 1.439±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | pka | 4.26±0.30(Predicted) | | InChI | 1S/C11H9NO4/c1-16-11(15)6-2-3-8-7(4-6)5-9(12-8)10(13)14/h2-5,12H,1H3,(H,13,14) | | InChIKey | KDLHRCGYOILAFD-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC2=CC(C(OC)=O)=CC=C2N1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-(Methoxycarbonyl)-1H-indole-2-carboxylicacid Usage And Synthesis |
| | 5-(Methoxycarbonyl)-1H-indole-2-carboxylicacid Preparation Products And Raw materials |
|