| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (indolin-4-yl)methanol Basic information |
| Product Name: | (indolin-4-yl)methanol | | Synonyms: | (indolin-4-yl)methanol;1H-Indole-4-Methanol,2,3-dihydro-;2,3-dihydro-1H-indol-4-ylMethanol;2,3-dihydro-1H-Indole-4-Methanol;(Indolin-4-yl) | | CAS: | 905274-11-5 | | MF: | C9H11NO | | MW: | 149.19 | | EINECS: | | | Product Categories: | | | Mol File: | 905274-11-5.mol |  |
| | (indolin-4-yl)methanol Chemical Properties |
| Boiling point | 312.6±21.0 °C(Predicted) | | density | 1.162±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 14.29±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C9H11NO/c11-6-7-2-1-3-9-8(7)4-5-10-9/h1-3,10-11H,4-6H2 | | InChIKey | KIAXWXLKHCRJMK-UHFFFAOYSA-N | | SMILES | N1C2=C(C(CO)=CC=C2)CC1 |
| | (indolin-4-yl)methanol Usage And Synthesis |
| | (indolin-4-yl)methanol Preparation Products And Raw materials |
|