|
|
| | 3-Fluoro-5-methoxyphenylacetonitrile Basic information |
| Product Name: | 3-Fluoro-5-methoxyphenylacetonitrile | | Synonyms: | 3-Fluoro-5-Methoxybenzyl cyanide;2-(3-Fluoro-5-Methoxyphenyl)acetonitrile;3-Fluoro-5-methoxybenzyl cyanide, 3-(Cyanomethyl)-5-fluoroanisole;Benzeneacetonitrile, 3-fluoro-5-methoxy- | | CAS: | 914637-31-3 | | MF: | C9H8FNO | | MW: | 165.16 | | EINECS: | | | Product Categories: | | | Mol File: | 914637-31-3.mol |  |
| | 3-Fluoro-5-methoxyphenylacetonitrile Chemical Properties |
| Boiling point | 249℃ | | density | 1.148 | | Fp | 105℃ | | storage temp. | Store at room temperature | | form | liquid | | color | Pale yellow | | InChI | InChI=1S/C9H8FNO/c1-12-9-5-7(2-3-11)4-8(10)6-9/h4-6H,2H2,1H3 | | InChIKey | VWYCYRCMXIAREJ-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC(OC)=CC(F)=C1 |
| RIDADR | 2810 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2909309090 |
| | 3-Fluoro-5-methoxyphenylacetonitrile Usage And Synthesis |
| Chemical Properties | Colorless Liquid |
| | 3-Fluoro-5-methoxyphenylacetonitrile Preparation Products And Raw materials |
|