|
|
| | 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran Basic information |
| Product Name: | 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran | | Synonyms: | 6-Bromo-4,4-dimethylthiochromane;Tazarotene Impurity 6;6-bromo-4,4-dimethyl-2,3-dihydrothiochromene;6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran;6-bromo-4,4-dimethyl-3,4-dihydro-2H-1-benzothiopyran;Tazarotene Impurity 1;2H-1-Benzothiopyran, 6-bromo-3,4-dihydro-4,4-dimethyl-;6-bromo-4,4-dimethyl-2,3-dihydro-1-benzothiopyran | | CAS: | 112110-44-8 | | MF: | C11H13BrS | | MW: | 257.19 | | EINECS: | | | Product Categories: | | | Mol File: | 112110-44-8.mol |  |
| | 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran Chemical Properties |
| Boiling point | 307.5±41.0 °C(Predicted) | | density | 1.351 | | storage temp. | 2-8°C | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C11H13BrS/c1-11(2)5-6-13-10-4-3-8(12)7-9(10)11/h3-4,7H,5-6H2,1-2H3 | | InChIKey | FLNJCJQFSGXLIR-UHFFFAOYSA-N | | SMILES | C1SC2=CC=C(Br)C=C2C(C)(C)C1 |
| | 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran Usage And Synthesis |
| | 6-Bromo-3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran Preparation Products And Raw materials |
|