- Palonosetron N-Oxide
-
- $1.00
-
2019-07-06
- CAS:813425-83-1
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 100kg
|
| | Palonosetron N-Oxide Basic information |
| Product Name: | Palonosetron N-Oxide | | Synonyms: | (3aS)-2,3,3a,4,5,6-Hexahydro-2-[(3S)-1-oxido-1-azabicyclo[2.2.2]oct-3-yl]-1H-benz[de]isoquinolin-1-one;1H-Benz[de]isoquinolin-1-one,2,3,3a,4,5,6-hexahydro-2-[(3S)-1-oxido-1-azabicyclo[2.2.2]oct-3-yl]-,(3aS)-;Palonosetron N-Oxide;(S)-3-((S)-1-oxo-3a,4,5,6-tetrahydro-1H-benzo[de]isoquinolin-2(3H)-yl)quinuclidine 1-oxide;PALONOSETRON USP RELATED COMPOUND A (PALONOSETRON N-OXIDE);Palonosetron Impurity 8(N-Oxide);Palonosetron USP Related Compound A;Palosetron nitrogen oxides | | CAS: | 813425-83-1 | | MF: | C19H24N2O2 | | MW: | 312.41 | | EINECS: | | | Product Categories: | Aromatics;Heterocycles;Metabolites & Impurities;Nitric Oxide Reagents | | Mol File: | 813425-83-1.mol |  |
| | Palonosetron N-Oxide Chemical Properties |
| Melting point | 62 - 65°C | | storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere | | solubility | Dichloromethane (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.72±0.40(Predicted) | | color | Light Yellow to Beige | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C19H24N2O2/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-20(19)17-12-21(23)9-7-13(17)8-10-21/h2,4,6,13,15,17H,1,3,5,7-12H2/t13,15-,17-,21/m1/s1 | | InChIKey | IQQIWUDYGYXXEA-BGAFOXLKSA-N | | SMILES | [N]21(=O)C[C@H](C(CC2)CC1)N3C[C@H]4CCCc5c4c(ccc5)C3=O |
| WGK Germany | WGK 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | Palonosetron N-Oxide Usage And Synthesis |
| Chemical Properties | Beige Solid | | Uses | A metabolite of Palonosetron (P165800). |
| | Palonosetron N-Oxide Preparation Products And Raw materials |
|