- 3-AMINO-2-NAPHTHOL
-
- $1.00 / 1g
-
2019-12-27
- CAS:5417-63-0
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 10000KGS
- 3-AMINO-2-NAPHTHOL
-
- $0.00 / 1g
-
2019-12-20
- CAS:5417-63-0
- Min. Order: 1g
- Purity: 95%min
- Supply Ability: 20kg/month
|
| | 3-AMINO-2-NAPHTHOL Basic information |
| | 3-AMINO-2-NAPHTHOL Chemical Properties |
| Melting point | 229-230 °C (lit.) | | Boiling point | 343.5±25.0 °C(Predicted) | | density | 1.281±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.36±0.40(Predicted) | | color | Pale Beige to Beige | | InChI | InChI=1S/C10H9NO/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6,12H,11H2 | | InChIKey | ZHVPTERSBUMMHK-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC(N)=C1O | | CAS DataBase Reference | 5417-63-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 26-36/37/39-45 | | WGK Germany | 3 | | Hazard Note | Harmful/Irritant | | HazardClass | IRRITANT | | HS Code | 29222990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-AMINO-2-NAPHTHOL Usage And Synthesis |
| Uses | 3-Amino-2-naphthol was used in the synthesis of 2-naphthyl-3-NHSO2CF3, 1-naphthyl-5-NHSO2CF3, benzoquinolinequinone and 3-chloro-2-napthol. | | Synthesis Reference(s) | Journal of the American Chemical Society, 72, p. 390, 1950 DOI: 10.1021/ja01157a105 |
| | 3-AMINO-2-NAPHTHOL Preparation Products And Raw materials |
|