|
|
| | 2-(Diphenylphosphino)-2'-methylbiphenyl Basic information |
| Product Name: | 2-(Diphenylphosphino)-2'-methylbiphenyl | | Synonyms: | 2-(Diphenylphosphino)-2'-methylbiphenyl;2-(DiphenylphosphiNA)-2'-Methylbiphenyl;2-(Diphenylphosphino)-2'-Methy;(2'-Methyl-[1,1'-biphenyl]-2-yl)diphenylphosphine;(2'-Methylbiphenyl-2-yl)diphenylphosphi;(2'-Methylbiphenyl-2-yl)diphenylphosphine;(2'-Methyl-[1,1'-biphenyl]-2-yl);(2'-Methyl-2-biphenylyl)(diphenyl)phosphine | | CAS: | 402822-72-4 | | MF: | C25H21P | | MW: | 352.41 | | EINECS: | 1312995-182-4 | | Product Categories: | | | Mol File: | 402822-72-4.mol |  |
| | 2-(Diphenylphosphino)-2'-methylbiphenyl Chemical Properties |
| Boiling point | 472.6±24.0 °C(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C25H21P/c1-20-12-8-9-17-23(20)24-18-10-11-19-25(24)26(21-13-4-2-5-14-21)22-15-6-3-7-16-22/h2-19H,1H3 | | InChIKey | GUENDLLDUNRPIC-UHFFFAOYSA-N | | SMILES | P(C1=CC=CC=C1C1=CC=CC=C1C)(C1=CC=CC=C1)C1=CC=CC=C1 |
| | 2-(Diphenylphosphino)-2'-methylbiphenyl Usage And Synthesis |
| | 2-(Diphenylphosphino)-2'-methylbiphenyl Preparation Products And Raw materials |
|