|
|
| | Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride Basic information |
| Product Name: | Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride | | Synonyms: | Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride;Bis[(2-diMethylaMino)phenyl]aMine nickel(II) chloride,98%;(SP-4-3)-Chloro[N2-[2-(diMethylaMino-κN)phenyl]-N1,N1-diMethyl-1,2-benzenediaMinato-κN1,κN2]nickel;Nickamine;Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride >=97% (AT);Bis[(2-dimethylamino)phenyl]aminenickel(II)chloride>=98.0%(AT);]amine nickeL | | CAS: | 1033772-47-2 | | MF: | C16H20ClN3Ni | | MW: | 348.5 | | EINECS: | | | Product Categories: | | | Mol File: | 1033772-47-2.mol | ![Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride Structure](CAS/GIF/1033772-47-2.gif) |
| | Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride Chemical Properties |
| storage temp. | 2-8°C, protect from light, stored under nitrogen | | form | Solid | | Appearance | Brown to black Solid | | InChI | 1S/C16H20N3.ClH.Ni/c1-18(2)15-11-7-5-9-13(15)17-14-10-6-8-12-16(14)19(3)4;;/h5-12H,1-4H3;1H;/q-1;;+2/p-1 | | InChIKey | IRLHVNUEEKJBEL-UHFFFAOYSA-M | | SMILES | CN(C)c1ccccc1N([Ni]Cl)c2ccccc2N(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride Usage And Synthesis |
| Uses | Bis[(2-dimethylamino)phenyl]amine Nickel(II) Chloride is a new pincer-type bis(amido)amine (NN2) ligand. The Ni(II) alkyl complexes react cleanly with alkyl halides including chlorides to form C-C cou
pled products and Ni(II) halides. | | Uses | Catalyst for:
- Alkyl-alkyl Kumada coupling of secondary alkyl halides
- Direct alkylation of heterocyclic C-H bonds
- Sonogashira coupling of nonactivated alkyl halides
- Kumada-Corriu-Tamao coupling of nonactivated alkyl halides with aryl and heteroaryl nucleophiles
Reactant of pincer NN2 ligand leading to selective carbon-carbon bond formation | | reaction suitability | core: nickel
reagent type: catalyst |
| | Bis[(2-dimethylamino)phenyl]amine nickel(II) chloride Preparation Products And Raw materials |
|