| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (S)-1-(Diphenylphosphino)-2-amino-3-methylbutane, min. 97% Basic information |
| Product Name: | (S)-1-(Diphenylphosphino)-2-amino-3-methylbutane, min. 97% | | Synonyms: | (S)-1-(Diphenylphosphino)-2-aMino-3-Methylbutane;(S)-1-(Diphenylphosphino)-3-Methyl-2-butylaMine;(S)-2-AMino-1-diphenylphosphino-3-Methylbutane, 97+%;(S)-1-(Diphenylphosphino)-3-methylbutan-2-amine;(S)-(+)-ValPHOS;(S)-(2-Amino-3-methylbutyl)diphenylphosphine;(2S)-1-(diphenylphosphino)-3-Methyl-2-ButanaMine;(S)-1-(Diphenylphosphino)-2-amino-3-methylbutane, min. 97% | | CAS: | 146476-37-1 | | MF: | C17H22NP | | MW: | 271.34 | | EINECS: | | | Product Categories: | Chiral Phosphine | | Mol File: | 146476-37-1.mol |  |
| | (S)-1-(Diphenylphosphino)-2-amino-3-methylbutane, min. 97% Chemical Properties |
| Boiling point | 374.8±25.0 °C(Predicted) | | density | 1.050 g/mL at 25 °C | | Fp | >110°(230°F) | | refractive index | 1.5970 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | liquid | | pka | 9.73±0.13(Predicted) | | Appearance | Colorless to light yellow Liquid | | Sensitive | Air Sensitive | | InChI | 1S/C17H22NP/c1-14(2)17(18)13-19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17H,13,18H2,1-2H3/t17-/m1/s1 | | InChIKey | ZZLCXURCZWQECA-QGZVFWFLSA-N | | SMILES | CC(C)[C@H](N)CP(c1ccccc1)c2ccccc2 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2735PSN1 8 / PGIII | | WGK Germany | 3 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | (S)-1-(Diphenylphosphino)-2-amino-3-methylbutane, min. 97% Usage And Synthesis |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
| | (S)-1-(Diphenylphosphino)-2-amino-3-methylbutane, min. 97% Preparation Products And Raw materials |
|