|
|
| | Benzo[C][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97% Basic information |
| Product Name: | Benzo[C][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97% | | Synonyms: | Benzo[C][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97%;2,1,3-Benzothiadiazole, 5-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)-;5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[c][1,2,5]thiadiazole;5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,1,3-benzothiadiazole, 2-(2,1,3-Benzothiadiazol-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;Benzo[c][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97%,;Benzo[c][1,2,5]thiadiazol-5-ylboronic acid pinacol ester;Benzo[c][1,2,5]thiadiazole-5-boronic Acid Pinacol Ester | | CAS: | 1168135-03-2 | | MF: | C12H15BN2O2S | | MW: | 262.14 | | EINECS: | | | Product Categories: | | | Mol File: | 1168135-03-2.mol | ![Benzo[C][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97% Structure](CAS/GIF/1168135-03-2.gif) |
| | Benzo[C][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97% Chemical Properties |
| Melting point | 81-86°C | | Boiling point | 366.3±15.0 °C(Predicted) | | density | 1.22±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -0.02±0.36(Predicted) | | form | Powder | | color | Brown | | InChI | 1S/C12H15BN2O2S/c1-11(2)12(3,4)17-13(16-11)8-5-6-9-10(7-8)15-18-14-9/h5-7H,1-4H3 | | InChIKey | KISHNZJGTMYYKH-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc3nsnc3c2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Benzo[C][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97% Usage And Synthesis |
| Uses | Benzo[c][1,2,5]thiadiazol-5-ylboronic acid pinacol ester can be used as a reactant:
- To synthesize 5-methylbenzo[c][1,2,5]thiadiazole by methylation reaction with methyl iodide using palladium catalyst.
- In the Miyaura borylation and Suzuki coupling reactions.
- To prepare benzothiadiazole derivatives as potent PFKFB3 kinase inhibitors.
|
| | Benzo[C][1,2,5]thiadiazole-5-boronic acid pinacol ester, 97% Preparation Products And Raw materials |
|