|
|
| | DECAFLUOROBUTANE Basic information |
| Product Name: | DECAFLUOROBUTANE | | Synonyms: | PERFLUORO-N-BUTANE 97%;Perfluorobutane (FC-31-10) 98%;Perfluorobutane(FC-31-10)98%;1,1,1,2,2,3,3,4,4,4-Decafluorobutane;1,1,1,2,2,3,3,4,4,4-Decafluoro-butane;Butane, decafluoro-;butane,decafluoro-;decafluoro-butan | | CAS: | 355-25-9 | | MF: | C4F10 | | MW: | 238.03 | | EINECS: | 206-580-3 | | Product Categories: | refrigerants | | Mol File: | 355-25-9.mol |  |
| | DECAFLUOROBUTANE Chemical Properties |
| Melting point | -84,5°C | | Boiling point | -2 °C | | density | 1,517 g/cm3 | | refractive index | 1.2482 (estimate) | | InChI | InChI=1S/C4F10/c5-1(6,3(9,10)11)2(7,8)4(12,13)14 | | InChIKey | KAVGMUDTWQVPDF-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 355-25-9(CAS DataBase Reference) | | EPA Substance Registry System | Perfluorobutane (355-25-9) |
| | DECAFLUOROBUTANE Usage And Synthesis |
| Uses | Ultrasound contrast agent intended for assessing
myocardial perfusion in patients with coronary artery
disease. | | Definition | ChEBI: Perflubutane is a fluorocarbon that is butane in which all of the hydrogens have been replaced by fluorines. Microbubbles of preflubutane are used in the ultrasound contrast agent BR14. It has a role as an ultrasound contrast agent. It is a gas molecular entity, a fluorocarbon and a fluoroalkane. |
| | DECAFLUOROBUTANE Preparation Products And Raw materials |
|