| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | JAK2 Inhibitor IV Basic information |
| Product Name: | JAK2 Inhibitor IV | | Synonyms: | JAK2 Inhibitor IV;JAK2 inhibitor 13;4-(3-Amino-1H-indazol-5-yl)-N-(2-methyl-2-propanyl)benzenesulfonamide;JAK2 inhibitor 13 - Sulfonamide 13;4-(3-amino-1H-indazol-5-yl)-N-(tert-butyl)benzenesulfonamide;Benzenesulfonamide, 4-(3-amino-1H-indazol-5-yl)-N-(1,1-dimethylethyl)- | | CAS: | 1110502-30-1 | | MF: | C17H20N4O2S | | MW: | 344.43 | | EINECS: | | | Product Categories: | | | Mol File: | 1110502-30-1.mol |  |
| | JAK2 Inhibitor IV Chemical Properties |
| Boiling point | 594.4±60.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | ethanol: 3mg/mL
DMSO: 5mg/mL | | form | Solid | | pka | 11.90±0.50(Predicted) | | color | pale yellow | | Sensitive | Light Sensitive | | InChI | 1S/C17H20N4O2S/c1-17(2,3)21-24(22,23)13-7-4-11(5-8-13)12-6-9-15-14(10-12)16(18)20-19-15/h4-10,21H,1-3H3,(H3,18,19,20) | | InChIKey | KFJCXIOVAGJCKB-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(NC(C)(C)C)c1ccc(cc1)c2cc3c([nH]nc3N)cc2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | JAK2 Inhibitor IV Usage And Synthesis |
| Uses | An aminoindazole compound that potently inhibits the activity of both the wild-type JAK2 and the active V617F mutant |
| | JAK2 Inhibitor IV Preparation Products And Raw materials |
|