|
|
| | ethyl 5-(hydroxymethyl)-1H-pyrazole-3-carboxylate Basic information | | Uses |
| Product Name: | ethyl 5-(hydroxymethyl)-1H-pyrazole-3-carboxylate | | Synonyms: | ethyl 5-(hydroxymethyl)-1H-pyrazole-3-carboxylate;Ethyl 5-(HydroxyMethyl)pyrazole-3-carboxylate;5-(hydroxymethyl)-1H-Pyrazole-3-carboxylic acid ethyl ester;5-hydroxymethyl-1(2)H-pyrazole-3-carboxylic acid ethyl ester;1H-Pyrazole-3-carboxylic acid, 5-(hydroxymethyl)-, ethyl ester;ethyl 3(5)-(hydroxymethyl)pyrazole-5(3)-carboxylate;ethyl 5-(hydroxymethyl)-1H-pyrazole-3-carboxylate ISO 9001：2015 REACH | | CAS: | 61453-48-3 | | MF: | C7H10N2O3 | | MW: | 170.17 | | EINECS: | | | Product Categories: | | | Mol File: | 61453-48-3.mol |  |
| | ethyl 5-(hydroxymethyl)-1H-pyrazole-3-carboxylate Chemical Properties |
| Melting point | 93 °C | | Boiling point | 399.0±32.0 °C(Predicted) | | density | 1.317±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | pka | 11.04±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H10N2O3/c1-2-12-7(11)6-3-5(4-10)8-9-6/h3,10H,2,4H2,1H3,(H,8,9) | | InChIKey | NRCLMYRLGIMSIX-UHFFFAOYSA-N | | SMILES | N1C(CO)=CC(C(OCC)=O)=N1 |
| | ethyl 5-(hydroxymethyl)-1H-pyrazole-3-carboxylate Usage And Synthesis |
| Uses | 5-(hydroxymethyl)pyrazole-3-carboxylic acid ethyl ester is a carboxylic acid ester derivative that can be used as a pharmaceutical intermediate. |
| | ethyl 5-(hydroxymethyl)-1H-pyrazole-3-carboxylate Preparation Products And Raw materials |
|