| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- 9,10-Dioxo Ketotifen
-
- $1.00
-
2026-08-07
- CAS:43076-16-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100000KG
|
| | 9,10-Dioxo Ketotifen Basic information |
| Product Name: | 9,10-Dioxo Ketotifen | | Synonyms: | 4-(1-Methylpiperidin-4-ylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophen-9,10-dione;10-(1-methylpiperidin-4-ylidene)benzo[1,2]cyclohepta[3,4-b]thiophene-4,5-dione;4-(1-methylpiperidin-4-ylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophene-9,10-dione;Ketotifen EP Impurity G;9,10-Dioxo Ketotifen;4-(1-Methyl-4-piperidinylidene)-4H-benzo[4,5]cyclohepta[1,2-b]thiophene-9,10-dione;Ketotifen FuMarate EP IMpurity G;Ketotifen Impurity 7(Ketotifen EP Impurity G) | | CAS: | 43076-16-0 | | MF: | C19H17NO2S | | MW: | 323.41 | | EINECS: | | | Product Categories: | Aromatics, Heterocycles, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals, Sulfur & Selenium Compounds;Aromatics;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Sulfur & Selenium Compounds | | Mol File: | 43076-16-0.mol |  |
| | 9,10-Dioxo Ketotifen Chemical Properties |
| Melting point | 200-201 °C (decomp) | | Boiling point | 505.7±50.0 °C(Predicted) | | density | 1.310±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly) | | pka | 8.67±0.20(Predicted) | | color | Yellow | | Stability: | Light sensitive | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C19H17NO2S/c1-20-9-6-12(7-10-20)16-13-4-2-3-5-14(13)17(21)18(22)19-15(16)8-11-23-19/h2-5,8,11H,6-7,9-10H2,1H3 | | InChIKey | SEWPKRUDHMXTMH-UHFFFAOYSA-N | | SMILES | [s]1c2c(cc1)C(=C4CCN(CC4)C)c3c(cccc3)C(=O)C2=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 9,10-Dioxo Ketotifen Usage And Synthesis |
| Uses | Ketotifen (K315100) impurity. The 9- and 10-oxo derivatives of Ketotifen as antihistaminics. |
| | 9,10-Dioxo Ketotifen Preparation Products And Raw materials |
|