| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | rac NorMetanephrine-d3 Hydrochloride Basic information |
| | rac NorMetanephrine-d3 Hydrochloride Chemical Properties |
| Melting point | 202-204°C | | Fp | 9℃ | | storage temp. | Refrigerator | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | color | White to Light Beige | | Stability: | Hygroscopic | | Major Application | clinical testing
clinical testing | | InChI | InChI=1S/C9H13NO3.ClH/c1-13-9-4-6(8(12)5-10)2-3-7(9)11;/h2-4,8,11-12H,5,10H2,1H3;1H | | InChIKey | VKFPRGQZWKTEON-UHFFFAOYSA-N | | SMILES | C([H])(C1C=CC(O)=C(OC)C=1)(O)C([H])([H])N.Cl | | CAS Number Unlabeled | 1011-74-1 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | rac NorMetanephrine-d3 Hydrochloride Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A labelled metabolite of Epinephrine (E588585). A naturally occurring derivative of Epinephrine, found together with Metanephrine in urine and in certain tissues. | | Uses | A labelled metabolite of Epinephrine (E588585). A naturraly occurring derivative of Epinephrine, found together with Metanephrine in urine and in certain tissues. | | General Description | Normetanephrine, a metabolite of norepinephrine, is a marker for catecholamine-secreting tumors such as pheochromocytoma. This internal standard is suitable for LC-MS/MS monitoring of normetanephrine levels in urine or plasma for diagnostic testing or endocrinology. |
| | rac NorMetanephrine-d3 Hydrochloride Preparation Products And Raw materials |
|