|
|
| | 5-piperazin-1-yl-1-benzofuran-2-carboxamide Basic information |
| Product Name: | 5-piperazin-1-yl-1-benzofuran-2-carboxamide | | Synonyms: | 1-(2-Aminocarbonylbenzofuran-5-yl)piperazine;5-(1-Piperazinyl)benzofuran-2-carboxamide;5-(piperazin-1-yl)benzofuran- 2-carboxaMide;5-{4-[4-(5-cyanoindol-3-yl)butyl]piperazin-1-yl}-1-benzofuran-2-carboxaMide;5-Piperazin-1-yl-benzofuran-2-carboxylic acid aMide;1-(2-AMinocarbonylbenzofuran-5-yl);Vilazodone int-3 5-(1-Piperazinyl)benzofuran-2-carboxamide;5-(Piperazine-1-yl) benzofuran-2-carboxamide | | CAS: | 183288-46-2 | | MF: | C13H15N3O2 | | MW: | 245.28 | | EINECS: | 1592732-453-0 | | Product Categories: | | | Mol File: | 183288-46-2.mol |  |
| | 5-piperazin-1-yl-1-benzofuran-2-carboxamide Chemical Properties |
| Melting point | >215°C (dec.) | | Boiling point | 505.3±40.0 °C(Predicted) | | density | 1.268 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated and Sonicated) | | pka | 15.79±0.30(Predicted) | | form | Solid | | color | Off-White to Yellow | | InChI | InChI=1S/C13H15N3O2/c14-13(17)12-8-9-7-10(1-2-11(9)18-12)16-5-3-15-4-6-16/h1-2,7-8,15H,3-6H2,(H2,14,17) | | InChIKey | LLRGOAFFRRUFBM-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(N3CCNCC3)C=C2C=C1C(N)=O |
| | 5-piperazin-1-yl-1-benzofuran-2-carboxamide Usage And Synthesis |
| Chemical Properties | Off-white Solid | | Uses | Intermediate in the synthesis of Vilazodone (V265000). |
| | 5-piperazin-1-yl-1-benzofuran-2-carboxamide Preparation Products And Raw materials |
|