|
|
| | tert-Butyl Methyl(3-oxopropyl)carbaMate Basic information | | Uses |
| Product Name: | tert-Butyl Methyl(3-oxopropyl)carbaMate | | Synonyms: | tert-Butyl Methyl(3-oxopropyl)carbaMate;N-Boc-N-methyl-3-amino-propanaldehyde;Methyl-(3-oxo-propyl)-carbamic acid tert-butyl ester;3-(Methylamino)propanal, N-Boc protected;Carbamic acid, N-methyl-N-(3-oxopropyl)-, 1,1-dimethylethyl ester;N-t-BOC-N-methyl-3-amino-propionaldehyde;N-Boc-3-(methylamino)propanal;Methyl (3-oxopropyl)carbamate tert-butyl ester | | CAS: | 273757-11-2 | | MF: | C9H17NO3 | | MW: | 187.24 | | EINECS: | | | Product Categories: | | | Mol File: | 273757-11-2.mol |  |
| | tert-Butyl Methyl(3-oxopropyl)carbaMate Chemical Properties |
| Boiling point | 250.5±19.0 °C(Predicted) | | density | 1.011±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | pka | -1.43±0.70(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10(4)6-5-7-11/h7H,5-6H2,1-4H3 | | InChIKey | JBAKABOTZNERRZ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)N(C)CCC=O |
| | tert-Butyl Methyl(3-oxopropyl)carbaMate Usage And Synthesis |
| Uses | tert-butyl methyl (3-oxopropyl)carbamate is a useful research chemical for organic synthesis and other chemical processes. |
| | tert-Butyl Methyl(3-oxopropyl)carbaMate Preparation Products And Raw materials |
|