| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
A.J Chemicals |
| Tel: |
91-9810153283 |
| Email: |
sales@ajchem.in |
| Company Name: |
Matrix Scientific |
| Tel: |
803 788-9494 All other calls |
| Email: |
sales@matrixscientific.com |
|
| | tert-Butyl 5-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate Basic information |
| | tert-Butyl 5-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate Chemical Properties |
| Boiling point | 407.8±48.0 °C(Predicted) | | density | 1.75±0.1 g/cm3(Predicted) | | pka | -0.81±0.30(Predicted) | | form | solid | | InChI | 1S/C11H12IN3O2/c1-11(2,3)17-10(16)15-9-7(5-14-15)4-8(12)6-13-9/h4-6H,1-3H3 | | InChIKey | OEWBCEOBCVBANN-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)n1ncc2cc(I)cnc12 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | tert-Butyl 5-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate Usage And Synthesis |
| | tert-Butyl 5-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate Preparation Products And Raw materials |
|