|
|
| | Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate Basic information |
| Product Name: | Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate | | Synonyms: | 4-(4-fluorophenyl)-3-pyrrolidinecarboxylic acid methyl ester;3-Pyrrolidinecarboxylic acid, 4-(4-fluorophenyl)-, methyl ester;Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate;Trans-Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate;Trans-methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate-HCl;trans-4-(4-Fluoro-phenyl)-pyrrolidine-3-carboxylic acid methyl ester | | CAS: | 939758-13-1 | | MF: | C12H14FNO2 | | MW: | 223.24 | | EINECS: | | | Product Categories: | | | Mol File: | 939758-13-1.mol |  |
| | Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate Chemical Properties |
| Boiling point | 306.4±42.0 °C(Predicted) | | density | 1.170±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.98±0.10(Predicted) | | form | solid | | InChI | 1S/C12H14FNO2/c1-16-12(15)11-7-14-6-10(11)8-2-4-9(13)5-3-8/h2-5,10-11,14H,6-7H2,1H3/t10-,11+/m1/s1 | | InChIKey | REBCUOWHHZXWGJ-MNOVXSKESA-N | | SMILES | FC1=CC=C([C@@H]2[C@@H](C(OC)=O)CNC2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 1
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate Usage And Synthesis |
| | Methyl 4-(4-fluorophenyl)pyrrolidine-3-carboxylate Preparation Products And Raw materials |
|