| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2,9-Bis[2-(4-fluorophenyl)ethyl]anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)tetrone
CAS:215726-57-1
Purity:95% Package:1G Remarks:763942-1G
|
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Email: |
service@3achem.com |
| Products Intro: |
Product Name:N,N'-Bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene dicarboximide
CAS:215726-57-1
Purity:Sublimed, > 99% Package:99999.00RMB/5g Remarks:A69957
|
| Company Name: |
Jiangsu aikang biomedical research and development co., LTD
|
| Tel: |
025-58859352 13155353615 |
| Email: |
qzhang@aikonchem.com |
| Products Intro: |
Product Name:2,9-Bis(4-fluorophenethyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone
CAS:215726-57-1
Purity:95% HPLC or GC Package:10G,5G;1G
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:2,9-Bis[2-(4-fluorophenyl)ethyl]anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)tetrone 95%
CAS:215726-57-1
Purity:95% Package:1g;1g;5g Remarks:NULL
|
|
| | N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide Basic information |
| Product Name: | N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide | | Synonyms: | 2,9-Bis[2-(4-fluorophenyl)ethyl]anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)tetrone 95%;N,N' -Bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene dicarboximide;4FPEPTC;N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide;2,9-Bis[2-(4-fluorophenyl)ethyl]anthra[2,1,9-def:6,5,10-d′e′f′]diisoquinoline-1,3,8,10(2H,9H)tetrone;Anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-bis[2-(4-fluorophenyl)ethyl]- (9CI);2,9-Bis(4-fluorophenethyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone;2,9-Bis(4-fluorophenethyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone | | CAS: | 215726-57-1 | | MF: | C40H24F2N2O4 | | MW: | 634.63 | | EINECS: | | | Product Categories: | | | Mol File: | 215726-57-1.mol | ![N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide Structure](CAS/20180713/GIF/215726-57-1.gif) |
| | N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide Chemical Properties |
| Melting point | 371-376°C | | form | solid | | InChIKey | NTVKTKREOVPUHX-UHFFFAOYSA-N | | SMILES | Fc1ccc(CCN2C(=O)c3ccc4c5ccc6C(=O)N(CCc7ccc(F)cc7)C(=O)c8ccc(c9ccc(C2=O)c3c49)c5c68)cc1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide Usage And Synthesis |
| Uses | Used in organic solar cells. | | General Description | The small molecules of this monomer offers advantages over its polymeric counterparts because
(a) their structures are well defined and exhibit no molecular weight dependence, leading to improved purity and limiting variation; and
(b) they exhibit more organized nanostructures, leading to higher charge carrier mobility.
Additionally, small molecule architectures are sensitive to minute structure changes; thus, properties like electronic energy levels, optical absorption, and self-assembly tendencies can be systemically tuned to maximize device performance. |
| | N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide Preparation Products And Raw materials |
|