|
|
| | ethyl 6-broMoindolizine-2-carboxylate Basic information | | Uses |
| | ethyl 6-broMoindolizine-2-carboxylate Chemical Properties |
| density | 1.49 | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C11H10BrNO2/c1-2-15-11(14)8-5-10-4-3-9(12)7-13(10)6-8/h3-7H,2H2,1H3 | | InChIKey | ALWPXYCZMXDKTH-UHFFFAOYSA-N | | SMILES | C1=C2N(C=C(Br)C=C2)C=C1C(OCC)=O |
| | ethyl 6-broMoindolizine-2-carboxylate Usage And Synthesis |
| Uses | 6-Bromo-2-indazine carboxylic acid ethyl ester is a carboxylic acid ester derivative that can be used as a pharmaceutical intermediate. |
| | ethyl 6-broMoindolizine-2-carboxylate Preparation Products And Raw materials |
|